2-cyano-3,3-diphenyl-2-propenoicaciethylester CAS#5232-99-5
| Ethyl 2-cyano-3,3-diphenylacrylate Chemical Properties |
| Melting point | 97-99 °C(lit.) |
| Boiling point | 174 °C0.2 mm Hg(lit.) |
| density | 1,05 g/cm3 |
| refractive index | 1.5100 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| color | White to Almost white |
| InChI | InChI=1S/C18H15NO2/c1-2-21-18(20)16(13-19)17(14-9-5-3-6-10-14)15-11-7-4-8-12-15/h3-12H,2H2,1H3 |
| InChIKey | IAJNXBNRYMEYAZ-UHFFFAOYSA-N |
| SMILES | C(OCC)(=O)/C(/C#N)=C(/C1=CC=CC=C1)\C1=CC=CC=C1 |
| LogP | 4.520 (est) |
| CAS DataBase Reference | 5232-99-5(CAS DataBase Reference) |
| EPA Substance Registry System | Ethyl 2-cyano-3,3-diphenylacrylate (5232-99-5) |
